C27H20I2N2O5 — CID 126008767
4-[[2,6-diiodo-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126008767) has the molecular formula C27H20I2N2O5 and a molecular weight of 706.27 g/mol. Its IUPAC name is 4-[[2,6-diiodo-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-diiodo-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126008767 |
| Molecular Formula | C27H20I2N2O5 |
| Molecular Weight | 706.27 g/mol |
| Exact Mass | 705.95 |
| IUPAC Name | 4-[[2,6-diiodo-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(COc1cccc2ccccc12)N/N=C/c1cc(I)c(OCc2ccc(C(=O)O)cc2)c(I)c1 |
| InChI | InChI=1S/C27H20I2N2O5/c28-22-12-18(13-23(29)26(22)36-15-17-8-10-20(11-9-17)27(33)34)14-30-31-25(32)16-35-24-7-3-5-19-4-1-2-6-21(19)24/h1-14H,15-16H2,(H,31,32)(H,33,34)/b30-14+ |
| InChIKey | YJHIDQKIFYCMFS-AMVVHIIESA-N |
| XLogP | 5.86 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.27 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|