C9H14O2S — CID 12601009
(Z)-2-propylsulfanylhex-2-en-4-yne-1,6-diol (PubChem CID 12601009) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (Z)-2-propylsulfanylhex-2-en-4-yne-1,6-diol.
| Compound Name | (Z)-2-propylsulfanylhex-2-en-4-yne-1,6-diol |
|---|---|
| PubChem CID | 12601009 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (Z)-2-propylsulfanylhex-2-en-4-yne-1,6-diol |
| SMILES | CCCS/C(=C\C#CCO)CO |
| InChI | InChI=1S/C9H14O2S/c1-2-7-12-9(8-11)5-3-4-6-10/h5,10-11H,2,6-8H2,1H3/b9-5- |
| InChIKey | YVLYRQXXLSXPGZ-UITAMQMPSA-N |
| XLogP | 1.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|