C9H11NO2S — CID 10352679
3-[(Z)-1,6-dihydroxyhex-2-en-4-yn-2-yl]sulfanylpropanenitrile (PubChem CID 10352679) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-[(Z)-1,6-dihydroxyhex-2-en-4-yn-2-yl]sulfanylpropanenitrile.
| Compound Name | 3-[(Z)-1,6-dihydroxyhex-2-en-4-yn-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 10352679 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 3-[(Z)-1,6-dihydroxyhex-2-en-4-yn-2-yl]sulfanylpropanenitrile |
| SMILES | N#CCCS/C(=C\C#CCO)CO |
| InChI | InChI=1S/C9H11NO2S/c10-5-3-7-13-9(8-12)4-1-2-6-11/h4,11-12H,3,6-8H2/b9-4- |
| InChIKey | JGPLHRJQZQTNRB-WTKPLQERSA-N |
| XLogP | 0.51 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|