C8H10N2S4 — CID 72543029
3-[2-(2-cyanoethylsulfanyl)-1,2-bis(sulfanyl)ethenyl]sulfanylpropanenitrile (PubChem CID 72543029) has the molecular formula C8H10N2S4 and a molecular weight of 262.45 g/mol. Its IUPAC name is 3-[2-(2-cyanoethylsulfanyl)-1,2-bis(sulfanyl)ethenyl]sulfanylpropanenitrile.
| Compound Name | 3-[2-(2-cyanoethylsulfanyl)-1,2-bis(sulfanyl)ethenyl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 72543029 |
| Molecular Formula | C8H10N2S4 |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 3-[2-(2-cyanoethylsulfanyl)-1,2-bis(sulfanyl)ethenyl]sulfanylpropanenitrile |
| SMILES | N#CCCSC(S)=C(S)SCCC#N |
| InChI | InChI=1S/C8H10N2S4/c9-3-1-5-13-7(11)8(12)14-6-2-4-10/h11-12H,1-2,5-6H2 |
| InChIKey | ZVQQPWBLFUHNPW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|