C22H15FN4O3S — CID 126016840
(5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126016840) has the molecular formula C22H15FN4O3S and a molecular weight of 434.45 g/mol. Its IUPAC name is (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126016840 |
| Molecular Formula | C22H15FN4O3S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(Sc3nc4ccccc4[nH]3)o2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H15FN4O3S/c23-14-7-5-13(6-8-14)12-27-20(28)18(26-22(27)29)11-15-9-10-19(30-15)31-21-24-16-3-1-2-4-17(16)25-21/h1-11H,12H2,(H,24,25)(H,26,29)/b18-11+ |
| InChIKey | BFRUNMHLPHWNQI-WOJGMQOQSA-N |
| XLogP | 4.54 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|