C20H24FNO — CID 126020152
4-fluoro-N-[(1S,2R)-2,5,5-trimethylcyclohexyl]naphthalene-1-carboxamide (PubChem CID 126020152) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-fluoro-N-[(1S,2R)-2,5,5-trimethylcyclohexyl]naphthalene-1-carboxamide.
| Compound Name | 4-fluoro-N-[(1S,2R)-2,5,5-trimethylcyclohexyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 126020152 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-fluoro-N-[(1S,2R)-2,5,5-trimethylcyclohexyl]naphthalene-1-carboxamide |
| SMILES | C[C@@H]1CCC(C)(C)C[C@@H]1NC(=O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C20H24FNO/c1-13-10-11-20(2,3)12-18(13)22-19(23)16-8-9-17(21)15-7-5-4-6-14(15)16/h4-9,13,18H,10-12H2,1-3H3,(H,22,23)/t13-,18+/m1/s1 |
| InChIKey | BLHHODDDSUBJSG-ACJLOTCBSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |