C19H18ClNO6 — CID 126025109
(2S)-2-[4-[(3-chloro-4-methoxycarbonylphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126025109) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is (2S)-2-[4-[(3-chloro-4-methoxycarbonylphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(3-chloro-4-methoxycarbonylphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126025109 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2S)-2-[4-[(3-chloro-4-methoxycarbonylphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc(O[C@@H](C)C(=O)O)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C19H18ClNO6/c1-11(18(22)23)27-16-7-4-12(8-17(16)25-2)10-21-13-5-6-14(15(20)9-13)19(24)26-3/h4-11H,1-3H3,(H,22,23)/b21-10+/t11-/m0/s1 |
| InChIKey | HQPTXXIYQBAZHV-JYQBEENSSA-N |
| XLogP | 3.74 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|