C19H21NO5 — CID 126019087
(2S)-2-[4-[(2-ethoxyphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126019087) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S)-2-[4-[(2-ethoxyphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(2-ethoxyphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126019087 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2S)-2-[4-[(2-ethoxyphenyl)iminomethyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | CCOc1ccccc1/N=C/c1ccc(O[C@@H](C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C19H21NO5/c1-4-24-16-8-6-5-7-15(16)20-12-14-9-10-17(18(11-14)23-3)25-13(2)19(21)22/h5-13H,4H2,1-3H3,(H,21,22)/b20-12+/t13-/m0/s1 |
| InChIKey | KJTDXEZNSSDYSI-DZUMZMOTSA-N |
| XLogP | 3.70 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|