C18H19NO5 — CID 126243355
(2R)-2-[2-methoxy-6-[(2-methoxyphenyl)iminomethyl]phenoxy]propanoic acid (PubChem CID 126243355) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-6-[(2-methoxyphenyl)iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-6-[(2-methoxyphenyl)iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126243355 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (2R)-2-[2-methoxy-6-[(2-methoxyphenyl)iminomethyl]phenoxy]propanoic acid |
| SMILES | COc1ccccc1/N=C/c1cccc(OC)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C18H19NO5/c1-12(18(20)21)24-17-13(7-6-10-16(17)23-3)11-19-14-8-4-5-9-15(14)22-2/h4-12H,1-3H3,(H,20,21)/b19-11+/t12-/m1/s1 |
| InChIKey | JTEWHNNMRGWGTH-ZGXHQARYSA-N |
| XLogP | 3.31 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|