C18H19NO4S — CID 126245097
(2R)-2-[2-methoxy-6-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]propanoic acid (PubChem CID 126245097) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-6-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-6-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126245097 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2R)-2-[2-methoxy-6-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]propanoic acid |
| SMILES | COc1cccc(/C=N/c2ccccc2SC)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C18H19NO4S/c1-12(18(20)21)23-17-13(7-6-9-15(17)22-2)11-19-14-8-4-5-10-16(14)24-3/h4-12H,1-3H3,(H,20,21)/b19-11+/t12-/m1/s1 |
| InChIKey | OIOUHDVHMQIGKA-ZGXHQARYSA-N |
| XLogP | 4.02 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|