C11H13NO5 — CID 126251082
(2R)-2-[2-(hydroxyiminomethyl)-6-methoxyphenoxy]propanoic acid (PubChem CID 126251082) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2R)-2-[2-(hydroxyiminomethyl)-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-(hydroxyiminomethyl)-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126251082 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2R)-2-[2-(hydroxyiminomethyl)-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cccc(C=NO)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C11H13NO5/c1-7(11(13)14)17-10-8(6-12-15)4-3-5-9(10)16-2/h3-7,15H,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | KFMMPELILLYAQG-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|