C29H27N3O3 — CID 126027803
2-[4-[(Z)-(diphenylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126027803) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[4-[(Z)-(diphenylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-(diphenylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126027803 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[4-[(Z)-(diphenylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(/C=N\N(c2ccccc2)c2ccccc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C29H27N3O3/c1-22-11-9-10-16-26(22)31-29(33)21-35-27-18-17-23(19-28(27)34-2)20-30-32(24-12-5-3-6-13-24)25-14-7-4-8-15-25/h3-20H,21H2,1-2H3,(H,31,33)/b30-20- |
| InChIKey | ZEGVQMUXGYXWEE-COEJQBHMSA-N |
| XLogP | 6.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|