C26H25N3O3 — CID 126030174
N-[(E)-[2-[(2R)-butan-2-yl]oxynaphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 126030174) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[(E)-[2-[(2R)-butan-2-yl]oxynaphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(E)-[2-[(2R)-butan-2-yl]oxynaphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 126030174 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[(E)-[2-[(2R)-butan-2-yl]oxynaphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | CC[C@@H](C)Oc1ccc2ccccc2c1/C=N/NC(=O)COc1cccc2cccnc12 |
| InChI | InChI=1S/C26H25N3O3/c1-3-18(2)32-23-14-13-19-8-4-5-11-21(19)22(23)16-28-29-25(30)17-31-24-12-6-9-20-10-7-15-27-26(20)24/h4-16,18H,3,17H2,1-2H3,(H,29,30)/b28-16+/t18-/m1/s1 |
| InChIKey | IDVBVIOVSOQKQK-GBYSFBBLSA-N |
| XLogP | 5.09 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|