C29H21Cl2N3O3 — CID 3733649
N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 3733649) has the molecular formula C29H21Cl2N3O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 3733649 |
| Molecular Formula | C29H21Cl2N3O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | O=C(COc1cccc2cccnc12)NN=Cc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C29H21Cl2N3O3/c30-22-12-10-21(25(31)15-22)17-36-26-13-11-19-5-1-2-8-23(19)24(26)16-33-34-28(35)18-37-27-9-3-6-20-7-4-14-32-29(20)27/h1-16H,17-18H2,(H,34,35) |
| InChIKey | SPYGAEBULFFYEW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|