C25H19N3O5S2 — CID 126045639
ethyl (2E,5R)-7-methyl-5-naphthalen-1-yl-2-[(5-nitrothiophen-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126045639) has the molecular formula C25H19N3O5S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is ethyl (2E,5R)-7-methyl-5-naphthalen-1-yl-2-[(5-nitrothiophen-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-7-methyl-5-naphthalen-1-yl-2-[(5-nitrothiophen-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126045639 |
| Molecular Formula | C25H19N3O5S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | ethyl (2E,5R)-7-methyl-5-naphthalen-1-yl-2-[(5-nitrothiophen-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc([N+](=O)[O-])s3)c(=O)n2[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H19N3O5S2/c1-3-33-24(30)21-14(2)26-25-27(22(21)18-10-6-8-15-7-4-5-9-17(15)18)23(29)19(35-25)13-16-11-12-20(34-16)28(31)32/h4-13,22H,3H2,1-2H3/b19-13+/t22-/m1/s1 |
| InChIKey | BXNYGFAMCUFJAW-OOIVEFLKSA-N |
| XLogP | 3.92 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|