C18H11Cl2FN2O4 — CID 126055002
5-[[3,5-dichloro-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126055002) has the molecular formula C18H11Cl2FN2O4 and a molecular weight of 409.20 g/mol. Its IUPAC name is 5-[[3,5-dichloro-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dichloro-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126055002 |
| Molecular Formula | C18H11Cl2FN2O4 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 5-[[3,5-dichloro-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2cc(Cl)cc(Cl)c2OCc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C18H11Cl2FN2O4/c19-11-5-10(6-12-16(24)22-18(26)23-17(12)25)15(13(20)7-11)27-8-9-3-1-2-4-14(9)21/h1-7H,8H2,(H2,22,23,24,25,26) |
| InChIKey | SJDBTUGHEZOXSX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|