C25H24N3O4+ — CID 126062777
N-[(1Z,4S,5R)-5-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126062777) has the molecular formula C25H24N3O4+ and a molecular weight of 430.48 g/mol. Its IUPAC name is N-[(1Z,4S,5R)-5-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | N-[(1Z,4S,5R)-5-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126062777 |
| Molecular Formula | C25H24N3O4+ |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[(1Z,4S,5R)-5-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
| SMILES | COc1ccc([C@@H]2[C@H](NC(=O)c3ccccc3)C(=O)N/[N+]2=C\c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-31-20-13-11-18(12-14-20)23-22(26-24(29)19-8-4-3-5-9-19)25(30)27-28(23)16-17-7-6-10-21(15-17)32-2/h3-16,22-23H,1-2H3,(H-,26,27,29,30)/p+1/b28-16-/t22-,23+/m0/s1 |
| InChIKey | DGLQMPVKAFMBTB-HFXBMHRVSA-O |
| XLogP | 2.72 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|