C27H23IN2O7S — CID 126074697
[4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] benzenesulfonate (PubChem CID 126074697) has the molecular formula C27H23IN2O7S and a molecular weight of 646.46 g/mol. Its IUPAC name is [4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] benzenesulfonate.
| Compound Name | [4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126074697 |
| Molecular Formula | C27H23IN2O7S |
| Molecular Weight | 646.46 g/mol |
| Exact Mass | 646.03 |
| IUPAC Name | [4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C)c(C)c3)C2=O)cc(I)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23IN2O7S/c1-4-36-23-15-18(14-22(28)24(23)37-38(34,35)20-8-6-5-7-9-20)13-21-25(31)29-27(33)30(26(21)32)19-11-10-16(2)17(3)12-19/h5-15H,4H2,1-3H3,(H,29,31,33)/b21-13+ |
| InChIKey | AJQRKBAZJHAYFY-FYJGNVAPSA-N |
| XLogP | 4.74 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|