C7H11N — CID 12607505
1-methyl-3,4-dimethylidenepyrrolidine (PubChem CID 12607505) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 1-methyl-3,4-dimethylidenepyrrolidine.
| Compound Name | 1-methyl-3,4-dimethylidenepyrrolidine |
|---|---|
| PubChem CID | 12607505 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 1-methyl-3,4-dimethylidenepyrrolidine |
| SMILES | C=C1CN(C)CC1=C |
| InChI | InChI=1S/C7H11N/c1-6-4-8(3)5-7(6)2/h1-2,4-5H2,3H3 |
| InChIKey | QRYVVLZUHLHZIP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |