C8H14BrN — CID 71421071
1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium bromide (PubChem CID 71421071) has the molecular formula C8H14BrN and a molecular weight of 204.11 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium bromide.
| Compound Name | 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium bromide |
|---|---|
| PubChem CID | 71421071 |
| Molecular Formula | C8H14BrN |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium bromide |
| SMILES | C=C1C[N+](C)(C)CC1=C.[Br-] |
| InChI | InChI=1S/C8H14N.BrH/c1-7-5-9(3,4)6-8(7)2;/h1-2,5-6H2,3-4H3;1H/q+1;/p-1 |
| InChIKey | LJBDXRJZYAHQJQ-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|