C24H16Cl2FIN2O3 — CID 126077344
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126077344) has the molecular formula C24H16Cl2FIN2O3 and a molecular weight of 597.21 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126077344 |
| Molecular Formula | C24H16Cl2FIN2O3 |
| Molecular Weight | 597.21 g/mol |
| Exact Mass | 595.96 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(OCc3ccc(Cl)cc3Cl)c(I)c2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C24H16Cl2FIN2O3/c25-17-7-6-16(18(26)11-17)13-33-22-8-5-14(9-20(22)28)10-21-23(31)30(24(32)29-21)12-15-3-1-2-4-19(15)27/h1-11H,12-13H2,(H,29,32)/b21-10+ |
| InChIKey | HRFUXGDTCWVFNT-UFFVCSGVSA-N |
| XLogP | 6.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.21 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|