C24H19N3O — CID 126078676
N-(5-methyl-2-phenylpyrazol-3-yl)-1-(3-phenylmethoxycyclohexa-1,3-dien-5-yn-1-yl)methanimine (PubChem CID 126078676) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is N-(5-methyl-2-phenylpyrazol-3-yl)-1-(3-phenylmethoxycyclohexa-1,3-dien-5-yn-1-yl)methanimine.
| Compound Name | N-(5-methyl-2-phenylpyrazol-3-yl)-1-(3-phenylmethoxycyclohexa-1,3-dien-5-yn-1-yl)methanimine |
|---|---|
| PubChem CID | 126078676 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-(5-methyl-2-phenylpyrazol-3-yl)-1-(3-phenylmethoxycyclohexa-1,3-dien-5-yn-1-yl)methanimine |
| SMILES | Cc1cc(N=Cc2c#ccc(OCc3ccccc3)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H19N3O/c1-19-15-24(27(26-19)22-12-6-3-7-13-22)25-17-21-11-8-14-23(16-21)28-18-20-9-4-2-5-10-20/h2-7,9-10,12-17H,18H2,1H3 |
| InChIKey | ROURYRGHKVLYND-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|