C13H10O — CID 142405796
2-phenylmethoxycyclohexa-1,3-dien-5-yne (PubChem CID 142405796) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-phenylmethoxycyclohexa-1,3-dien-5-yne.
| Compound Name | 2-phenylmethoxycyclohexa-1,3-dien-5-yne |
|---|---|
| PubChem CID | 142405796 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-phenylmethoxycyclohexa-1,3-dien-5-yne |
| SMILES | c1ccc(OCc2ccccc2)cc#1 |
| InChI | InChI=1S/C13H10O/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1,3-5,7-10H,11H2 |
| InChIKey | GQAPJDOOCQIJHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |