C23H25BrN4O8S2 — CID 126081359
methyl 2-[4-[bis(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methyl]-2-bromo-6-methoxyphenoxy]acetate (PubChem CID 126081359) has the molecular formula C23H25BrN4O8S2 and a molecular weight of 629.51 g/mol. Its IUPAC name is methyl 2-[4-[bis(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methyl]-2-bromo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[bis(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methyl]-2-bromo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126081359 |
| Molecular Formula | C23H25BrN4O8S2 |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 628.03 |
| IUPAC Name | methyl 2-[4-[bis(4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)methyl]-2-bromo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(C(c2c(O)n(C)c(=S)n(C)c2=O)c2c(O)n(C)c(=S)n(C)c2=O)cc1OC |
| InChI | InChI=1S/C23H25BrN4O8S2/c1-25-18(30)15(19(31)26(2)22(25)37)14(16-20(32)27(3)23(38)28(4)21(16)33)10-7-11(24)17(12(8-10)34-5)36-9-13(29)35-6/h7-8,14,30,32H,9H2,1-6H3 |
| InChIKey | WFRBGQGAAPFRJM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|