C27H26N2OS — CID 126084868
(6R)-6-tert-butyl-2-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126084868) has the molecular formula C27H26N2OS and a molecular weight of 426.59 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6R)-6-tert-butyl-2-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126084868 |
| Molecular Formula | C27H26N2OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (6R)-6-tert-butyl-2-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | C#CCOc1ccc2ccccc2c1C=Nc1sc2c(c1C#N)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C27H26N2OS/c1-5-14-30-24-13-10-18-8-6-7-9-20(18)23(24)17-29-26-22(16-28)21-12-11-19(27(2,3)4)15-25(21)31-26/h1,6-10,13,17,19H,11-12,14-15H2,2-4H3/t19-/m1/s1 |
| InChIKey | IKUXOSMKJDNQEU-LJQANCHMSA-N |
| XLogP | 6.69 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|