C24H23ClN4OS — CID 126086570
(5Z)-2-(4-chlorophenyl)imino-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126086570) has the molecular formula C24H23ClN4OS and a molecular weight of 451.00 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126086570 |
| Molecular Formula | C24H23ClN4OS |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(C)n(-c3cccnc3)c2C)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN4OS/c1-4-12-28-23(30)22(31-24(28)27-20-9-7-19(25)8-10-20)14-18-13-16(2)29(17(18)3)21-6-5-11-26-15-21/h5-11,13-15H,4,12H2,1-3H3/b22-14-,27-24+ |
| InChIKey | MWSVSFLZEBQARX-GKOYHKHUSA-N |
| XLogP | 6.16 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|