C24H23N3OS2 — CID 2927500
5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2927500) has the molecular formula C24H23N3OS2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2927500 |
| Molecular Formula | C24H23N3OS2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C=C2SC(=S)N(CCCc3ccccc3)C2=O)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C24H23N3OS2/c1-17-14-20(18(2)27(17)21-11-6-12-25-16-21)15-22-23(28)26(24(29)30-22)13-7-10-19-8-4-3-5-9-19/h3-6,8-9,11-12,14-16H,7,10,13H2,1-2H3 |
| InChIKey | NEOZWYJXFJHYJO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|