C22H23N2O3S2- — CID 2312293
6-[(5Z)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 2312293) has the molecular formula C22H23N2O3S2- and a molecular weight of 427.57 g/mol. Its IUPAC name is 6-[(5Z)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | 6-[(5Z)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 2312293 |
| Molecular Formula | C22H23N2O3S2- |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-[(5Z)-5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | Cc1cc(/C=C2\SC(=S)N(CCCCCC(=O)[O-])C2=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S2/c1-15-13-17(16(2)24(15)18-9-5-3-6-10-18)14-19-21(27)23(22(28)29-19)12-8-4-7-11-20(25)26/h3,5-6,9-10,13-14H,4,7-8,11-12H2,1-2H3,(H,25,26)/p-1/b19-14- |
| InChIKey | WELSZEIUODNEBT-RGEXLXHISA-M |
| XLogP | 3.61 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|