C17H16N3O3S3- — CID 9334202
4-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 9334202) has the molecular formula C17H16N3O3S3- and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | 4-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 9334202 |
| Molecular Formula | C17H16N3O3S3- |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 4-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | Cc1cc(/C=C2\SC(=S)N(CCCC(=O)[O-])C2=O)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C17H17N3O3S3/c1-10-8-12(11(2)20(10)16-18-5-7-25-16)9-13-15(23)19(17(24)26-13)6-3-4-14(21)22/h5,7-9H,3-4,6H2,1-2H3,(H,21,22)/p-1/b13-9- |
| InChIKey | HFLHBNHROFYRIZ-LCYFTJDESA-M |
| XLogP | 2.28 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|