C16H15N3O3S3 — CID 9334190
3-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 9334190) has the molecular formula C16H15N3O3S3 and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 9334190 |
| Molecular Formula | C16H15N3O3S3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-[(5Z)-5-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1cc(/C=C2\SC(=S)N(CCC(=O)O)C2=O)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C16H15N3O3S3/c1-9-7-11(10(2)19(9)15-17-4-6-24-15)8-12-14(22)18(16(23)25-12)5-3-13(20)21/h4,6-8H,3,5H2,1-2H3,(H,20,21)/b12-8- |
| InChIKey | FDOKCBPWQZOYLK-WQLSENKSSA-N |
| XLogP | 3.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|