C33H28Cl2IN3O7S — CID 126089400
propan-2-yl (2E,5S)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126089400) has the molecular formula C33H28Cl2IN3O7S and a molecular weight of 808.48 g/mol. Its IUPAC name is propan-2-yl (2E,5S)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl (2E,5S)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126089400 |
| Molecular Formula | C33H28Cl2IN3O7S |
| Molecular Weight | 808.48 g/mol |
| Exact Mass | 807.01 |
| IUPAC Name | propan-2-yl (2E,5S)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1cc(/C=c2/sc3n(c2=O)[C@@H](c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C(C)N=3)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H28Cl2IN3O7S/c1-5-44-26-13-20(12-25(36)30(26)45-16-19-9-10-23(34)24(35)11-19)14-27-31(40)38-29(21-7-6-8-22(15-21)39(42)43)28(32(41)46-17(2)3)18(4)37-33(38)47-27/h6-15,17,29H,5,16H2,1-4H3/b27-14+/t29-/m0/s1 |
| InChIKey | NIPOHISPWLMYQI-ZTJHJZSNSA-N |
| XLogP | 6.98 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.48 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|