C31H24FI2N3O6S — CID 126089568
propan-2-yl (2E,5R)-2-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126089568) has the molecular formula C31H24FI2N3O6S and a molecular weight of 839.42 g/mol. Its IUPAC name is propan-2-yl (2E,5R)-2-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl (2E,5R)-2-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126089568 |
| Molecular Formula | C31H24FI2N3O6S |
| Molecular Weight | 839.42 g/mol |
| Exact Mass | 838.95 |
| IUPAC Name | propan-2-yl (2E,5R)-2-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@@H](c2cccc([N+](=O)[O-])c2)n2c(s/c(=C/c3cc(I)c(OCc4ccccc4F)c(I)c3)c2=O)=N1 |
| InChI | InChI=1S/C31H24FI2N3O6S/c1-16(2)43-30(39)26-17(3)35-31-36(27(26)19-8-6-9-21(14-19)37(40)41)29(38)25(44-31)13-18-11-23(33)28(24(34)12-18)42-15-20-7-4-5-10-22(20)32/h4-14,16,27H,15H2,1-3H3/b25-13+/t27-/m1/s1 |
| InChIKey | KSLQUHLCRVRRDL-CCVBWGSMSA-N |
| XLogP | 6.02 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|