C12H13FN4O6 — CID 12608954
[(Z)-[amino-(3-fluorophenyl)methylidene]amino] 4,4-dinitropentanoate (PubChem CID 12608954) has the molecular formula C12H13FN4O6 and a molecular weight of 328.26 g/mol. Its IUPAC name is [(Z)-[amino-(3-fluorophenyl)methylidene]amino] 4,4-dinitropentanoate.
| Compound Name | [(Z)-[amino-(3-fluorophenyl)methylidene]amino] 4,4-dinitropentanoate |
|---|---|
| PubChem CID | 12608954 |
| Molecular Formula | C12H13FN4O6 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | [(Z)-[amino-(3-fluorophenyl)methylidene]amino] 4,4-dinitropentanoate |
| SMILES | CC(CCC(=O)O/N=C(\N)c1cccc(F)c1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H13FN4O6/c1-12(16(19)20,17(21)22)6-5-10(18)23-15-11(14)8-3-2-4-9(13)7-8/h2-4,7H,5-6H2,1H3,(H2,14,15) |
| InChIKey | WQEZHIILCFOUAA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|