C13H16N4O7 — CID 12608961
[(Z)-[amino-(2-methoxyphenyl)methylidene]amino] 4,4-dinitropentanoate (PubChem CID 12608961) has the molecular formula C13H16N4O7 and a molecular weight of 340.29 g/mol. Its IUPAC name is [(Z)-[amino-(2-methoxyphenyl)methylidene]amino] 4,4-dinitropentanoate.
| Compound Name | [(Z)-[amino-(2-methoxyphenyl)methylidene]amino] 4,4-dinitropentanoate |
|---|---|
| PubChem CID | 12608961 |
| Molecular Formula | C13H16N4O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(Z)-[amino-(2-methoxyphenyl)methylidene]amino] 4,4-dinitropentanoate |
| SMILES | COc1ccccc1/C(N)=N/OC(=O)CCC(C)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O7/c1-13(16(19)20,17(21)22)8-7-11(18)24-15-12(14)9-5-3-4-6-10(9)23-2/h3-6H,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | RXUIHOIGGGZIJZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 160.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|