C22H22BrFN2O4 — CID 126104379
(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126104379) has the molecular formula C22H22BrFN2O4 and a molecular weight of 477.33 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126104379 |
| Molecular Formula | C22H22BrFN2O4 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CC[C@H](C)Oc1c(Br)cc(/C=C2/NC(=O)N(Cc3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C22H22BrFN2O4/c1-4-13(2)30-20-16(23)9-14(11-19(20)29-3)10-18-21(27)26(22(28)25-18)12-15-7-5-6-8-17(15)24/h5-11,13H,4,12H2,1-3H3,(H,25,28)/b18-10+/t13-/m0/s1 |
| InChIKey | PEWWVRQETKAMRX-SGPNVBEDSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|