C20H14BrCl2NO4S2 — CID 126104718
3-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 126104718) has the molecular formula C20H14BrCl2NO4S2 and a molecular weight of 547.28 g/mol. Its IUPAC name is 3-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 126104718 |
| Molecular Formula | C20H14BrCl2NO4S2 |
| Molecular Weight | 547.28 g/mol |
| Exact Mass | 544.89 |
| IUPAC Name | 3-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)SC1=S |
| InChI | InChI=1S/C20H14BrCl2NO4S2/c21-13-7-11(9-17-19(27)24(20(29)30-17)6-5-18(25)26)2-4-16(13)28-10-12-1-3-14(22)15(23)8-12/h1-4,7-9H,5-6,10H2,(H,25,26)/b17-9+ |
| InChIKey | PRWZCZFDHLVNKN-RQZCQDPDSA-N |
| XLogP | 6.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.28 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|