C33H39N5O6S — CID 126106752
(2Z,5R)-2-[[2-(azepan-1-yl)-5-nitrophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126106752) has the molecular formula C33H39N5O6S and a molecular weight of 633.77 g/mol. Its IUPAC name is (2Z,5R)-2-[[2-(azepan-1-yl)-5-nitrophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5R)-2-[[2-(azepan-1-yl)-5-nitrophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126106752 |
| Molecular Formula | C33H39N5O6S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | (2Z,5R)-2-[[2-(azepan-1-yl)-5-nitrophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3N3CCCCCC3)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C33H39N5O6S/c1-6-35(7-2)32(40)29-21(3)34-33-37(30(29)25-20-24(43-4)13-15-27(25)44-5)31(39)28(45-33)19-22-18-23(38(41)42)12-14-26(22)36-16-10-8-9-11-17-36/h12-15,18-20,30H,6-11,16-17H2,1-5H3/b28-19-/t30-/m1/s1 |
| InChIKey | NCRKNEXXVMYOOV-WWWKDLBZSA-N |
| XLogP | 4.41 |
| TPSA | 119.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|