C32H38N6O6S — CID 126089832
(2Z,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126089832) has the molecular formula C32H38N6O6S and a molecular weight of 634.76 g/mol. Its IUPAC name is (2Z,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126089832 |
| Molecular Formula | C32H38N6O6S |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | (2Z,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)c(=O)n2[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C32H38N6O6S/c1-7-35(8-2)31(40)28-20(3)33-32-37(29(28)24-19-23(43-5)10-12-26(24)44-6)30(39)27(45-32)18-21-17-22(38(41)42)9-11-25(21)36-15-13-34(4)14-16-36/h9-12,17-19,29H,7-8,13-16H2,1-6H3/b27-18-/t29-/m0/s1 |
| InChIKey | ASVQKOFOWOCCKT-HDFSHUSISA-N |
| XLogP | 2.78 |
| TPSA | 122.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|