C25H23N3O4S — CID 1261213
[4-(benzenesulfonyl)piperazin-1-yl]-[2-(5-methylfuran-2-yl)quinolin-4-yl]methanone (PubChem CID 1261213) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-[2-(5-methylfuran-2-yl)quinolin-4-yl]methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-[2-(5-methylfuran-2-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 1261213 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-[2-(5-methylfuran-2-yl)quinolin-4-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(S(=O)(=O)c4ccccc4)CC3)c3ccccc3n2)o1 |
| InChI | InChI=1S/C25H23N3O4S/c1-18-11-12-24(32-18)23-17-21(20-9-5-6-10-22(20)26-23)25(29)27-13-15-28(16-14-27)33(30,31)19-7-3-2-4-8-19/h2-12,17H,13-16H2,1H3 |
| InChIKey | OQOFRTKXGJABRC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |