C34H39N3O6S — CID 166185301
[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-[2-(3,4,5-trimethoxyphenyl)quinolin-4-yl]methanone (PubChem CID 166185301) has the molecular formula C34H39N3O6S and a molecular weight of 617.77 g/mol. Its IUPAC name is [4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-[2-(3,4,5-trimethoxyphenyl)quinolin-4-yl]methanone.
| Compound Name | [4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-[2-(3,4,5-trimethoxyphenyl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 166185301 |
| Molecular Formula | C34H39N3O6S |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | [4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-[2-(3,4,5-trimethoxyphenyl)quinolin-4-yl]methanone |
| SMILES | COc1cc(-c2cc(C(=O)N3CCN(S(=O)(=O)c4c(C)c(C)c(C)c(C)c4C)CC3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C34H39N3O6S/c1-20-21(2)23(4)33(24(5)22(20)3)44(39,40)37-15-13-36(14-16-37)34(38)27-19-29(35-28-12-10-9-11-26(27)28)25-17-30(41-6)32(43-8)31(18-25)42-7/h9-12,17-19H,13-16H2,1-8H3 |
| InChIKey | QCRQHACDCBWGEO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |