C25H21FN4O3S — CID 55614291
[2-(4-fluorophenyl)quinolin-4-yl]-(4-pyridin-3-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 55614291) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-(4-fluorophenyl)quinolin-4-yl]-(4-pyridin-3-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)quinolin-4-yl]-(4-pyridin-3-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 55614291 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [2-(4-fluorophenyl)quinolin-4-yl]-(4-pyridin-3-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)nc2ccccc12)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C25H21FN4O3S/c26-19-9-7-18(8-10-19)24-16-22(21-5-1-2-6-23(21)28-24)25(31)29-12-14-30(15-13-29)34(32,33)20-4-3-11-27-17-20/h1-11,16-17H,12-15H2 |
| InChIKey | TYGXFHSRAWLEFC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |