C21H15ClF3NOS — CID 126129121
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 126129121) has the molecular formula C21H15ClF3NOS and a molecular weight of 421.87 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 126129121 |
| Molecular Formula | C21H15ClF3NOS |
| Molecular Weight | 421.87 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C21H15ClF3NOS/c22-18-11-10-16(21(23,24)25)12-19(18)26-20(27)15-8-6-14(7-9-15)13-28-17-4-2-1-3-5-17/h1-12H,13H2,(H,26,27) |
| InChIKey | BXDRXJYWDQSCTL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |