C15H15N3O6 — CID 126129777
(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126129777) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is (5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126129777 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc([N+](=O)[O-])c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C15H15N3O6/c1-4-5-17-14(19)10(16-15(17)20)6-9-7-11(18(21)22)13(24-3)8-12(9)23-2/h4,6-8H,1,5H2,2-3H3,(H,16,20)/b10-6+ |
| InChIKey | HGVIPCVMWXEQKT-UXBLZVDNSA-N |
| XLogP | 1.69 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|