C30H28N2O2S — CID 126131698
(5E)-3-(cyclohexylmethyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126131698) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126131698 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cn(Cc3ccc4ccccc4c3)c3ccccc23)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C30H28N2O2S/c33-29-28(35-30(34)32(29)19-21-8-2-1-3-9-21)17-25-20-31(27-13-7-6-12-26(25)27)18-22-14-15-23-10-4-5-11-24(23)16-22/h4-7,10-17,20-21H,1-3,8-9,18-19H2/b28-17+ |
| InChIKey | MFGUXNZCZGUJDP-OGLMXYFKSA-N |
| XLogP | 7.46 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|