C19H18OS — CID 12613199
3,4-dimethylspiro[2,5-dihydrothiopyran-6,9'-xanthene] (PubChem CID 12613199) has the molecular formula C19H18OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 3,4-dimethylspiro[2,5-dihydrothiopyran-6,9'-xanthene].
| Compound Name | 3,4-dimethylspiro[2,5-dihydrothiopyran-6,9'-xanthene] |
|---|---|
| PubChem CID | 12613199 |
| Molecular Formula | C19H18OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3,4-dimethylspiro[2,5-dihydrothiopyran-6,9'-xanthene] |
| SMILES | CC1=C(C)CC2(SC1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C19H18OS/c1-13-11-19(21-12-14(13)2)15-7-3-5-9-17(15)20-18-10-6-4-8-16(18)19/h3-10H,11-12H2,1-2H3 |
| InChIKey | BTWQIGJDASBODB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|