C29H27BrN2O5S — CID 126132575
2-[5-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 126132575) has the molecular formula C29H27BrN2O5S and a molecular weight of 595.52 g/mol. Its IUPAC name is 2-[5-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[5-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126132575 |
| Molecular Formula | C29H27BrN2O5S |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | 2-[5-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)c(Br)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H27BrN2O5S/c1-2-36-24-16-21(23(30)18-25(24)37-19-27(33)31-22-13-7-4-8-14-22)17-26-28(34)32(29(35)38-26)15-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-14,16-18H,2,9,12,15,19H2,1H3,(H,31,33)/b26-17+ |
| InChIKey | BJNSKNZKDCFBEG-YZSQISJMSA-N |
| XLogP | 6.53 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|