C11H9Br2NO4S — CID 126139774
(5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126139774) has the molecular formula C11H9Br2NO4S and a molecular weight of 411.07 g/mol. Its IUPAC name is (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126139774 |
| Molecular Formula | C11H9Br2NO4S |
| Molecular Weight | 411.07 g/mol |
| Exact Mass | 408.86 |
| IUPAC Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCN1C(=O)S/C(=C/c2cc(Br)c(Br)o2)C1=O |
| InChI | InChI=1S/C11H9Br2NO4S/c1-17-3-2-14-10(15)8(19-11(14)16)5-6-4-7(12)9(13)18-6/h4-5H,2-3H2,1H3/b8-5+ |
| InChIKey | MPWWCJCLPIPJBZ-VMPITWQZSA-N |
| XLogP | 3.49 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.07 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|