C26H30N2O4S — CID 126146434
methyl 3-[3-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoate (PubChem CID 126146434) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is methyl 3-[3-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoate.
| Compound Name | methyl 3-[3-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 126146434 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | methyl 3-[3-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(-n2c(C)cc(/C=C3/SC(=O)N(CC4CCCCC4)C3=O)c2C)c1 |
| InChI | InChI=1S/C26H30N2O4S/c1-16-10-11-20(25(30)32-4)13-22(16)28-17(2)12-21(18(28)3)14-23-24(29)27(26(31)33-23)15-19-8-6-5-7-9-19/h10-14,19H,5-9,15H2,1-4H3/b23-14+ |
| InChIKey | DZMNQPZJJDVHOS-OEAKJJBVSA-N |
| XLogP | 5.81 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|