C21H20N6O6S — CID 126148083
methyl 4-[[2-[[4-methyl-5-[[(3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126148083) has the molecular formula C21H20N6O6S and a molecular weight of 484.49 g/mol. Its IUPAC name is methyl 4-[[2-[[4-methyl-5-[[(3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[4-methyl-5-[[(3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126148083 |
| Molecular Formula | C21H20N6O6S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | methyl 4-[[2-[[4-methyl-5-[[(3-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nnc(CNC(=O)c3cccc([N+](=O)[O-])c3)n2C)cc1 |
| InChI | InChI=1S/C21H20N6O6S/c1-26-17(11-22-19(29)14-4-3-5-16(10-14)27(31)32)24-25-21(26)34-12-18(28)23-15-8-6-13(7-9-15)20(30)33-2/h3-10H,11-12H2,1-2H3,(H,22,29)(H,23,28) |
| InChIKey | IYWQGMTXGPYUMS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|