C24H17BrCl2FNO2S2 — CID 126148474
(5S)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126148474) has the molecular formula C24H17BrCl2FNO2S2 and a molecular weight of 585.35 g/mol. Its IUPAC name is (5S)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126148474 |
| Molecular Formula | C24H17BrCl2FNO2S2 |
| Molecular Weight | 585.35 g/mol |
| Exact Mass | 582.92 |
| IUPAC Name | (5S)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1[C@H](Cc2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)SC(=S)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17BrCl2FNO2S2/c25-17-4-8-21(31-13-15-3-7-19(26)20(27)9-15)16(10-17)11-22-23(30)29(24(32)33-22)12-14-1-5-18(28)6-2-14/h1-10,22H,11-13H2/t22-/m0/s1 |
| InChIKey | BYDYDVSQBFMKCE-QFIPXVFZSA-N |
| XLogP | 7.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.35 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|